C21H27F3N2O2 — CID 143881932
N-[(4E,6E,8E)-1-amino-3-ethyl-9-hydroxy-6-(trifluoromethyl)nona-4,6,8-trien-4-yl]-3,4-dimethylbenzamide (PubChem CID 143881932) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[(4E,6E,8E)-1-amino-3-ethyl-9-hydroxy-6-(trifluoromethyl)nona-4,6,8-trien-4-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[(4E,6E,8E)-1-amino-3-ethyl-9-hydroxy-6-(trifluoromethyl)nona-4,6,8-trien-4-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 143881932 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[(4E,6E,8E)-1-amino-3-ethyl-9-hydroxy-6-(trifluoromethyl)nona-4,6,8-trien-4-yl]-3,4-dimethylbenzamide |
| SMILES | CCC(CCN)/C(=C\C(=C/C=C/O)C(F)(F)F)NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H27F3N2O2/c1-4-16(9-10-25)19(13-18(6-5-11-27)21(22,23)24)26-20(28)17-8-7-14(2)15(3)12-17/h5-8,11-13,16,27H,4,9-10,25H2,1-3H3,(H,26,28)/b11-5+,18-6+,19-13+ |
| InChIKey | GXXIQLKQOHLGAF-BGYIRFARSA-N |
| XLogP | 4.85 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|