C16H15F3N2O — CID 143882339
2-[(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 143882339) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 143882339 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[(3E,5Z)-5-ethylhepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | C=C/C=C(C(=C/C)\CC)/c1nc2cc(C(F)(F)F)cnc2o1 |
| InChI | InChI=1S/C16H15F3N2O/c1-4-7-12(10(5-2)6-3)14-21-13-8-11(16(17,18)19)9-20-15(13)22-14/h4-5,7-9H,1,6H2,2-3H3/b10-5-,12-7+ |
| InChIKey | OQDXBMJDHUWNNE-KVPZAXMQSA-N |
| XLogP | 5.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|