C15H20N2 — CID 143882569
3-[(3Z,6Z,8Z)-5-methylidenedeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-amine (PubChem CID 143882569) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-[(3Z,6Z,8Z)-5-methylidenedeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-amine.
| Compound Name | 3-[(3Z,6Z,8Z)-5-methylidenedeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-amine |
|---|---|
| PubChem CID | 143882569 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-[(3Z,6Z,8Z)-5-methylidenedeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-amine |
| SMILES | C=C/C=C(\N=C(/C)C(=C)N)C(=C)/C=C\C=C/C |
| InChI | InChI=1S/C15H20N2/c1-6-8-9-11-12(3)15(10-7-2)17-14(5)13(4)16/h6-11H,2-4,16H2,1,5H3/b8-6-,11-9-,15-10-,17-14+ |
| InChIKey | ZVTBFVQBUBFBKU-HWWKXQAJSA-N |
| XLogP | 3.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|