About 4,8-dimethylnaphthalene-1,5-diamine;ethane
4,8-dimethylnaphthalene-1,5-diamine;ethane (PubChem CID 143882753) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 4,8-dimethylnaphthalene-1,5-diamine;ethane.
Molecular Properties
| Compound Name | 4,8-dimethylnaphthalene-1,5-diamine;ethane |
| PubChem CID | 143882753 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4,8-dimethylnaphthalene-1,5-diamine;ethane |
| SMILES | CC.CC.Cc1ccc(N)c2c(C)ccc(N)c12 |
| InChI | InChI=1S/C12H14N2.2C2H6/c1-7-3-5-10(14)12-8(2)4-6-9(13)11(7)12;2*1-2/h3-6H,13-14H2,1-2H3;2*1-2H3 |
| InChIKey | UQHAECUTYMWIGE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dimethylnaphthalene-1,5-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylnaphthalene-1,5-diamine;ethane?
The IUPAC name of 4,8-dimethylnaphthalene-1,5-diamine;ethane (CID 143882753) is 4,8-dimethylnaphthalene-1,5-diamine;ethane.
What is the SMILES notation for 4,8-dimethylnaphthalene-1,5-diamine;ethane?
The canonical SMILES for 4,8-dimethylnaphthalene-1,5-diamine;ethane is CC.CC.Cc1ccc(N)c2c(C)ccc(N)c12.
What is the InChIKey of 4,8-dimethylnaphthalene-1,5-diamine;ethane?
The InChIKey is UQHAECUTYMWIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.2C2H6/c1-7-3-5-10(14)12-8(2)4-6-9(13)11(7)12;2*1-2/h3-6H,13-14H2,1-2H3;2*1-2H3.
What are the key properties of 4,8-dimethylnaphthalene-1,5-diamine;ethane?
4,8-dimethylnaphthalene-1,5-diamine;ethane has a molecular weight of 246.40 g/mol, XLogP of 4.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnaphthalene-1,5-diamine;ethane is sourced from PubChem (CID 143882753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).