About (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide
(2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide (PubChem CID 143883061) has the molecular formula C10H16FN3
and a molecular weight of 197.26 g/mol. Its IUPAC name is (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide |
| PubChem CID | 143883061 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C(F)\C(=N/C)NC1CCNC1 |
| InChI | InChI=1S/C10H16FN3/c1-3-4-9(11)10(12-2)14-8-5-6-13-7-8/h3-4,8,13H,1,5-7H2,2H3,(H,12,14)/b9-4+ |
| InChIKey | SBROCAQGWHGQHK-RUDMXATFSA-N |
| XLogP | 1.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide?
The IUPAC name of (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide (CID 143883061) is (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide.
What is the SMILES notation for (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide?
The canonical SMILES for (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide is C=C/C=C(F)\C(=N/C)NC1CCNC1.
What is the InChIKey of (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide?
The InChIKey is SBROCAQGWHGQHK-RUDMXATFSA-N. The full InChI is InChI=1S/C10H16FN3/c1-3-4-9(11)10(12-2)14-8-5-6-13-7-8/h3-4,8,13H,1,5-7H2,2H3,(H,12,14)/b9-4+.
What are the key properties of (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide?
(2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide has a molecular weight of 197.26 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-fluoro-N'-methyl-N-pyrrolidin-3-ylpenta-2,4-dienimidamide is sourced from PubChem (CID 143883061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).