C17H11ClF5NO4S2 — CID 143883254
N-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)cyclobutylidene]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143883254) has the molecular formula C17H11ClF5NO4S2 and a molecular weight of 487.86 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)cyclobutylidene]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)cyclobutylidene]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143883254 |
| Molecular Formula | C17H11ClF5NO4S2 |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 486.97 |
| IUPAC Name | N-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)cyclobutylidene]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(N=C1CC(c2cc(F)ccc2F)(S(=O)(=O)c2ccc(Cl)cc2)C1)C(F)(F)F |
| InChI | InChI=1S/C17H11ClF5NO4S2/c18-10-1-4-13(5-2-10)29(25,26)16(14-7-11(19)3-6-15(14)20)8-12(9-16)24-30(27,28)17(21,22)23/h1-7H,8-9H2/b24-12- |
| InChIKey | XNSVCGXLAIVPDI-MSXFZWOLSA-N |
| XLogP | 4.37 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|