About ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine
ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 143883331) has the molecular formula C9H13F3N2O
and a molecular weight of 222.21 g/mol. Its IUPAC name is ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine.
Molecular Properties
| Compound Name | ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine |
| PubChem CID | 143883331 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | CC.Cc1cc(OCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C7H7F3N2O.C2H6/c1-5-2-6(12-4-11-5)13-3-7(8,9)10;1-2/h2,4H,3H2,1H3;1-2H3 |
| InChIKey | ZJJGAFURKXATRP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine?
The IUPAC name of ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine (CID 143883331) is ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine.
What is the SMILES notation for ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine?
The canonical SMILES for ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine is CC.Cc1cc(OCC(F)(F)F)ncn1.
What is the InChIKey of ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine?
The InChIKey is ZJJGAFURKXATRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O.C2H6/c1-5-2-6(12-4-11-5)13-3-7(8,9)10;1-2/h2,4H,3H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine?
ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine has a molecular weight of 222.21 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine is sourced from PubChem (CID 143883331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).