About 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine
4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine (PubChem CID 143883700) has the molecular formula C10H14FN3
and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine |
| PubChem CID | 143883700 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine |
| SMILES | Cc1nc(N(C)C)nc(C2CC2)c1F |
| InChI | InChI=1S/C10H14FN3/c1-6-8(11)9(7-4-5-7)13-10(12-6)14(2)3/h7H,4-5H2,1-3H3 |
| InChIKey | ITGRLMXYVHSIND-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The IUPAC name of 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine (CID 143883700) is 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine.
What is the SMILES notation for 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The canonical SMILES for 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine is Cc1nc(N(C)C)nc(C2CC2)c1F.
What is the InChIKey of 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The InChIKey is ITGRLMXYVHSIND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3/c1-6-8(11)9(7-4-5-7)13-10(12-6)14(2)3/h7H,4-5H2,1-3H3.
What are the key properties of 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine has a molecular weight of 195.24 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-fluoro-N,N,6-trimethylpyrimidin-2-amine is sourced from PubChem (CID 143883700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).