About 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine
4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine (PubChem CID 143883705) has the molecular formula C9H14FN3O
and a molecular weight of 199.23 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine |
| PubChem CID | 143883705 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine |
| SMILES | CCOc1nc(N(C)C)nc(C)c1F |
| InChI | InChI=1S/C9H14FN3O/c1-5-14-8-7(10)6(2)11-9(12-8)13(3)4/h5H2,1-4H3 |
| InChIKey | XZIVCZDQDHJGQU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The IUPAC name of 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine (CID 143883705) is 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine.
What is the SMILES notation for 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The canonical SMILES for 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine is CCOc1nc(N(C)C)nc(C)c1F.
What is the InChIKey of 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
The InChIKey is XZIVCZDQDHJGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O/c1-5-14-8-7(10)6(2)11-9(12-8)13(3)4/h5H2,1-4H3.
What are the key properties of 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine?
4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine has a molecular weight of 199.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-5-fluoro-N,N,6-trimethylpyrimidin-2-amine is sourced from PubChem (CID 143883705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).