About [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene
[3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene (PubChem CID 143884183) has the molecular formula C21H32Cl2O4
and a molecular weight of 419.39 g/mol. Its IUPAC name is [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene.
Molecular Properties
| Compound Name | [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene |
| PubChem CID | 143884183 |
| Molecular Formula | C21H32Cl2O4 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene |
| SMILES | C/C=C\CCCC.O=CO.OCc1cc(Cl)cc(OCC2CCC(Cl)C2)c1 |
| InChI | InChI=1S/C13H16Cl2O2.C7H14.CH2O2/c14-11-2-1-9(3-11)8-17-13-5-10(7-16)4-12(15)6-13;1-3-5-7-6-4-2;2-1-3/h4-6,9,11,16H,1-3,7-8H2;3,5H,4,6-7H2,1-2H3;1H,(H,2,3)/b;5-3-; |
| InChIKey | RAEYIVFSHUOVHM-FMFSYIAASA-N |
| XLogP | 6.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene?
The IUPAC name of [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene (CID 143884183) is [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene.
What is the SMILES notation for [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene?
The canonical SMILES for [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene is C/C=C\CCCC.O=CO.OCc1cc(Cl)cc(OCC2CCC(Cl)C2)c1.
What is the InChIKey of [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene?
The InChIKey is RAEYIVFSHUOVHM-FMFSYIAASA-N. The full InChI is InChI=1S/C13H16Cl2O2.C7H14.CH2O2/c14-11-2-1-9(3-11)8-17-13-5-10(7-16)4-12(15)6-13;1-3-5-7-6-4-2;2-1-3/h4-6,9,11,16H,1-3,7-8H2;3,5H,4,6-7H2,1-2H3;1H,(H,2,3)/b;5-3-;.
What are the key properties of [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene?
[3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene has a molecular weight of 419.39 g/mol, XLogP of 6.07, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol;formic acid;(Z)-hept-2-ene is sourced from PubChem (CID 143884183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).