C22H32N2O3S — CID 143885050
ethane;(4Z)-2-[[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid;hydrate (PubChem CID 143885050) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is ethane;(4Z)-2-[[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid;hydrate.
| Compound Name | ethane;(4Z)-2-[[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid;hydrate |
|---|---|
| PubChem CID | 143885050 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethane;(4Z)-2-[[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid;hydrate |
| SMILES | C=C/C=C(\C=C/C)CC(Nc1nc(C(/C=C\C)=C/C=C)cs1)C(=O)O.CC.O |
| InChI | InChI=1S/C20H24N2O2S.C2H6.H2O/c1-5-9-15(10-6-2)13-17(19(23)24)21-20-22-18(14-25-20)16(11-7-3)12-8-4;1-2;/h5-12,14,17H,1,3,13H2,2,4H3,(H,21,22)(H,23,24);1-2H3;1H2/b10-6-,12-8-,15-9+,16-11+;; |
| InChIKey | FOHTZBIUHNNDDE-VPMFMTPMSA-N |
| XLogP | 5.43 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|