C24H33NO — CID 143885429
3-[(5S,6R)-5-methoxy-6-(4-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl]-N,N-dimethylpropan-1-amine (PubChem CID 143885429) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 3-[(5S,6R)-5-methoxy-6-(4-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(5S,6R)-5-methoxy-6-(4-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 143885429 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3-[(5S,6R)-5-methoxy-6-(4-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CO[C@]1(CCCN(C)C)c2ccccc2CCC[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33NO/c1-19-13-15-21(16-14-19)23-12-7-10-20-9-5-6-11-22(20)24(23,26-4)17-8-18-25(2)3/h5-6,9,11,13-16,23H,7-8,10,12,17-18H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | QYRZOAIIMUDBNN-DNQXCXABSA-N |
| XLogP | 5.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |