About 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone
2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone (PubChem CID 143885546) has the molecular formula C22H20N2O3S2
and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone.
Molecular Properties
| Compound Name | 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone |
| PubChem CID | 143885546 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone |
| SMILES | CC(=O)c1cccnc1.Cc1nc2ccc(-c3cccc(S(C)(=O)=O)c3)cc2s1 |
| InChI | InChI=1S/C15H13NO2S2.C7H7NO/c1-10-16-14-7-6-12(9-15(14)19-10)11-4-3-5-13(8-11)20(2,17)18;1-6(9)7-3-2-4-8-5-7/h3-9H,1-2H3;2-5H,1H3 |
| InChIKey | IPRSUMFUFQRNDX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone?
The IUPAC name of 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone (CID 143885546) is 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone.
What is the SMILES notation for 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone?
The canonical SMILES for 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone is CC(=O)c1cccnc1.Cc1nc2ccc(-c3cccc(S(C)(=O)=O)c3)cc2s1.
What is the InChIKey of 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone?
The InChIKey is IPRSUMFUFQRNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S2.C7H7NO/c1-10-16-14-7-6-12(9-15(14)19-10)11-4-3-5-13(8-11)20(2,17)18;1-6(9)7-3-2-4-8-5-7/h3-9H,1-2H3;2-5H,1H3.
What are the key properties of 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone?
2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone has a molecular weight of 424.55 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(3-methylsulfonylphenyl)-1,3-benzothiazole;1-pyridin-3-ylethanone is sourced from PubChem (CID 143885546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).