C31H34O — CID 143885745
1-[3,4-bis(prop-1-en-2-yl)phenyl]-4-phenylpent-4-en-1-one;1,3-xylene (PubChem CID 143885745) has the molecular formula C31H34O and a molecular weight of 422.61 g/mol. Its IUPAC name is 1-[3,4-bis(prop-1-en-2-yl)phenyl]-4-phenylpent-4-en-1-one;1,3-xylene.
| Compound Name | 1-[3,4-bis(prop-1-en-2-yl)phenyl]-4-phenylpent-4-en-1-one;1,3-xylene |
|---|---|
| PubChem CID | 143885745 |
| Molecular Formula | C31H34O |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-[3,4-bis(prop-1-en-2-yl)phenyl]-4-phenylpent-4-en-1-one;1,3-xylene |
| SMILES | C=C(CCC(=O)c1ccc(C(=C)C)c(C(=C)C)c1)c1ccccc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C23H24O.C8H10/c1-16(2)21-13-12-20(15-22(21)17(3)4)23(24)14-11-18(5)19-9-7-6-8-10-19;1-7-4-3-5-8(2)6-7/h6-10,12-13,15H,1,3,5,11,14H2,2,4H3;3-6H,1-2H3 |
| InChIKey | ABBZOTIPCCXHCP-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |