About 2-ethoxyethyl 2-iminoethanimidate
2-ethoxyethyl 2-iminoethanimidate (PubChem CID 143885971) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-ethoxyethyl 2-iminoethanimidate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-iminoethanimidate |
| PubChem CID | 143885971 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-ethoxyethyl 2-iminoethanimidate |
| SMILES | [H]/N=C(/C=N/[H])OCCOCC |
| InChI | InChI=1S/C6H12N2O2/c1-2-9-3-4-10-6(8)5-7/h5,7-8H,2-4H2,1H3/b7-5+,8-6- |
| InChIKey | RLSYEOOTZMOPTF-YMBWGVAGSA-N |
| XLogP | 0.67 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-iminoethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-iminoethanimidate?
The IUPAC name of 2-ethoxyethyl 2-iminoethanimidate (CID 143885971) is 2-ethoxyethyl 2-iminoethanimidate.
What is the SMILES notation for 2-ethoxyethyl 2-iminoethanimidate?
The canonical SMILES for 2-ethoxyethyl 2-iminoethanimidate is [H]/N=C(/C=N/[H])OCCOCC.
What is the InChIKey of 2-ethoxyethyl 2-iminoethanimidate?
The InChIKey is RLSYEOOTZMOPTF-YMBWGVAGSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-2-9-3-4-10-6(8)5-7/h5,7-8H,2-4H2,1H3/b7-5+,8-6-.
What are the key properties of 2-ethoxyethyl 2-iminoethanimidate?
2-ethoxyethyl 2-iminoethanimidate has a molecular weight of 144.17 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-iminoethanimidate is sourced from PubChem (CID 143885971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).