About bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate
bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate (PubChem CID 143886066) has the molecular formula C15H14BrNO4
and a molecular weight of 352.18 g/mol. Its IUPAC name is bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate |
| PubChem CID | 143886066 |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate |
| SMILES | CC1CC(=O)N(c2ccc(C=CC(=O)OCBr)cc2)C1=O |
| InChI | InChI=1S/C15H14BrNO4/c1-10-8-13(18)17(15(10)20)12-5-2-11(3-6-12)4-7-14(19)21-9-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | VVWOYQZLCUDOMD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate?
The IUPAC name of bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate (CID 143886066) is bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate.
What is the SMILES notation for bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate?
The canonical SMILES for bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate is CC1CC(=O)N(c2ccc(C=CC(=O)OCBr)cc2)C1=O.
What is the InChIKey of bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate?
The InChIKey is VVWOYQZLCUDOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrNO4/c1-10-8-13(18)17(15(10)20)12-5-2-11(3-6-12)4-7-14(19)21-9-16/h2-7,10H,8-9H2,1H3.
What are the key properties of bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate?
bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate has a molecular weight of 352.18 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethyl 3-[4-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoate is sourced from PubChem (CID 143886066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).