C10H8ClNS2 — CID 143886123
5-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazole (PubChem CID 143886123) has the molecular formula C10H8ClNS2 and a molecular weight of 241.77 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazole.
| Compound Name | 5-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 143886123 |
| Molecular Formula | C10H8ClNS2 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 5-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazole |
| SMILES | Clc1cccc(CSc2cncs2)c1 |
| InChI | InChI=1S/C10H8ClNS2/c11-9-3-1-2-8(4-9)6-13-10-5-12-7-14-10/h1-5,7H,6H2 |
| InChIKey | OJGKOJBGLVJZKM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |