C33H40N4O4 — CID 143886368
N-[(Z)-C-[(2E,4Z)-4-[4-[[4-butyl-1-(4-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]hepta-2,4-dien-3-yl]-N-methoxycarbonimidoyl]formamide (PubChem CID 143886368) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-[(Z)-C-[(2E,4Z)-4-[4-[[4-butyl-1-(4-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]hepta-2,4-dien-3-yl]-N-methoxycarbonimidoyl]formamide.
| Compound Name | N-[(Z)-C-[(2E,4Z)-4-[4-[[4-butyl-1-(4-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]hepta-2,4-dien-3-yl]-N-methoxycarbonimidoyl]formamide |
|---|---|
| PubChem CID | 143886368 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | N-[(Z)-C-[(2E,4Z)-4-[4-[[4-butyl-1-(4-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]hepta-2,4-dien-3-yl]-N-methoxycarbonimidoyl]formamide |
| SMILES | C/C=C(C(=C/CC)\c1ccc(Cc2c(CCCC)nc(C)n(-c3ccc(OC)cc3)c2=O)cc1)/C(=N/OC)NC=O |
| InChI | InChI=1S/C33H40N4O4/c1-7-10-12-31-30(33(39)37(23(4)35-31)26-17-19-27(40-5)20-18-26)21-24-13-15-25(16-14-24)29(11-8-2)28(9-3)32(34-22-38)36-41-6/h9,11,13-20,22H,7-8,10,12,21H2,1-6H3,(H,34,36,38)/b28-9+,29-11- |
| InChIKey | FYBFLTSINDPZNM-RUPRLSTQSA-N |
| XLogP | 5.93 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|