C35H42N4O4 — CID 143886473
2-[4-[[4-butyl-2-methyl-1-(3-methyl-4-propan-2-yloxyphenyl)-6-oxopyrimidin-5-yl]methyl]phenyl]-N-hydroxy-N'-methylbenzenecarboximidamide;formaldehyde (PubChem CID 143886473) has the molecular formula C35H42N4O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-[4-[[4-butyl-2-methyl-1-(3-methyl-4-propan-2-yloxyphenyl)-6-oxopyrimidin-5-yl]methyl]phenyl]-N-hydroxy-N'-methylbenzenecarboximidamide;formaldehyde.
| Compound Name | 2-[4-[[4-butyl-2-methyl-1-(3-methyl-4-propan-2-yloxyphenyl)-6-oxopyrimidin-5-yl]methyl]phenyl]-N-hydroxy-N'-methylbenzenecarboximidamide;formaldehyde |
|---|---|
| PubChem CID | 143886473 |
| Molecular Formula | C35H42N4O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 2-[4-[[4-butyl-2-methyl-1-(3-methyl-4-propan-2-yloxyphenyl)-6-oxopyrimidin-5-yl]methyl]phenyl]-N-hydroxy-N'-methylbenzenecarboximidamide;formaldehyde |
| SMILES | C=O.CCCCc1nc(C)n(-c2ccc(OC(C)C)c(C)c2)c(=O)c1Cc1ccc(-c2ccccc2/C(=N/C)NO)cc1 |
| InChI | InChI=1S/C34H40N4O3.CH2O/c1-7-8-13-31-30(34(39)38(24(5)36-31)27-18-19-32(23(4)20-27)41-22(2)3)21-25-14-16-26(17-15-25)28-11-9-10-12-29(28)33(35-6)37-40;1-2/h9-12,14-20,22,40H,7-8,13,21H2,1-6H3,(H,35,37);1H2 |
| InChIKey | QJNNGRDFJLPRGZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|