C36H43N5O2 — CID 143887443
N-[2-[4-(methylamino)phenyl]ethyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine;N-pentylformamide;prop-1-ene (PubChem CID 143887443) has the molecular formula C36H43N5O2 and a molecular weight of 577.77 g/mol. Its IUPAC name is N-[2-[4-(methylamino)phenyl]ethyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine;N-pentylformamide;prop-1-ene.
| Compound Name | N-[2-[4-(methylamino)phenyl]ethyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine;N-pentylformamide;prop-1-ene |
|---|---|
| PubChem CID | 143887443 |
| Molecular Formula | C36H43N5O2 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | N-[2-[4-(methylamino)phenyl]ethyl]-5,6-diphenylfuro[2,3-d]pyrimidin-4-amine;N-pentylformamide;prop-1-ene |
| SMILES | C=CC.CCCCCNC=O.CNc1ccc(CCNc2ncnc3oc(-c4ccccc4)c(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C27H24N4O.C6H13NO.C3H6/c1-28-22-14-12-19(13-15-22)16-17-29-26-24-23(20-8-4-2-5-9-20)25(21-10-6-3-7-11-21)32-27(24)31-18-30-26;1-2-3-4-5-7-6-8;1-3-2/h2-15,18,28H,16-17H2,1H3,(H,29,30,31);6H,2-5H2,1H3,(H,7,8);3H,1H2,2H3 |
| InChIKey | PQYBJPIGSDCYCO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|