C23H32N6O — CID 143887455
11-[3-(dimethylamino)propyl]-N-[2-[4-(methylamino)phenyl]ethyl]-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 143887455) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 11-[3-(dimethylamino)propyl]-N-[2-[4-(methylamino)phenyl]ethyl]-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 11-[3-(dimethylamino)propyl]-N-[2-[4-(methylamino)phenyl]ethyl]-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 143887455 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 11-[3-(dimethylamino)propyl]-N-[2-[4-(methylamino)phenyl]ethyl]-8-oxa-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CNc1ccc(CCNc2ncnc3oc4c(c23)CCN(CCCN(C)C)C4)cc1 |
| InChI | InChI=1S/C23H32N6O/c1-24-18-7-5-17(6-8-18)9-11-25-22-21-19-10-14-29(13-4-12-28(2)3)15-20(19)30-23(21)27-16-26-22/h5-8,16,24H,4,9-15H2,1-3H3,(H,25,26,27) |
| InChIKey | NAMIAIKXDFONGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |