C9H15NO2S3 — CID 143888029
4-[[(2Z,4Z)-5-aminopenta-2,4-dienyl]disulfanyl]-2-sulfanylbutanoic acid (PubChem CID 143888029) has the molecular formula C9H15NO2S3 and a molecular weight of 265.42 g/mol. Its IUPAC name is 4-[[(2Z,4Z)-5-aminopenta-2,4-dienyl]disulfanyl]-2-sulfanylbutanoic acid.
| Compound Name | 4-[[(2Z,4Z)-5-aminopenta-2,4-dienyl]disulfanyl]-2-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 143888029 |
| Molecular Formula | C9H15NO2S3 |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 4-[[(2Z,4Z)-5-aminopenta-2,4-dienyl]disulfanyl]-2-sulfanylbutanoic acid |
| SMILES | N/C=C\C=C/CSSCCC(S)C(=O)O |
| InChI | InChI=1S/C9H15NO2S3/c10-5-2-1-3-6-14-15-7-4-8(13)9(11)12/h1-3,5,8,13H,4,6-7,10H2,(H,11,12)/b3-1-,5-2- |
| InChIKey | GGHHVSJQIRNUSG-LEWNYYKSSA-N |
| XLogP | 2.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|