About 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate
1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate (PubChem CID 143888196) has the molecular formula C22H26N4O2
and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate.
Molecular Properties
| Compound Name | 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate |
| PubChem CID | 143888196 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate |
| SMILES | [H]/N=C(/CCCCc1cccc(-c2nc3ccccc3nc2OC)c1)OC(C)N |
| InChI | InChI=1S/C22H26N4O2/c1-15(23)28-20(24)13-6-3-8-16-9-7-10-17(14-16)21-22(27-2)26-19-12-5-4-11-18(19)25-21/h4-5,7,9-12,14-15,24H,3,6,8,13,23H2,1-2H3/b24-20- |
| InChIKey | FWEKYLYZNNJJJA-GFMRDNFCSA-N |
| XLogP | 4.32 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate?
The IUPAC name of 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate (CID 143888196) is 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate.
What is the SMILES notation for 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate?
The canonical SMILES for 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate is [H]/N=C(/CCCCc1cccc(-c2nc3ccccc3nc2OC)c1)OC(C)N.
What is the InChIKey of 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate?
The InChIKey is FWEKYLYZNNJJJA-GFMRDNFCSA-N. The full InChI is InChI=1S/C22H26N4O2/c1-15(23)28-20(24)13-6-3-8-16-9-7-10-17(14-16)21-22(27-2)26-19-12-5-4-11-18(19)25-21/h4-5,7,9-12,14-15,24H,3,6,8,13,23H2,1-2H3/b24-20-.
What are the key properties of 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate?
1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate has a molecular weight of 378.48 g/mol, XLogP of 4.32, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 5-[3-(3-methoxyquinoxalin-2-yl)phenyl]pentanimidate is sourced from PubChem (CID 143888196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).