C18H28N4 — CID 143888648
N-[3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-2-methylpropylidene]-N'-methylmethanimidamide;molecular hydrogen (PubChem CID 143888648) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-2-methylpropylidene]-N'-methylmethanimidamide;molecular hydrogen.
| Compound Name | N-[3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-2-methylpropylidene]-N'-methylmethanimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 143888648 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-[3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-2-methylpropylidene]-N'-methylmethanimidamide;molecular hydrogen |
| SMILES | C/N=C/N=C/C(C)Cc1ccc2[nH]cc(CCN(C)C)c2c1.[H][H] |
| InChI | InChI=1S/C18H26N4.H2/c1-14(11-20-13-19-2)9-15-5-6-18-17(10-15)16(12-21-18)7-8-22(3)4;/h5-6,10-14,21H,7-9H2,1-4H3;1H/b19-13+,20-11+; |
| InChIKey | BTYRBQAGIJWLQP-VMQSLFSOSA-N |
| XLogP | 3.43 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|