C13H19NO6 — CID 143888765
(3S,5R)-2-(hydroxymethyl)-6-(4-methylanilino)oxyoxane-3,4,5-triol (PubChem CID 143888765) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (3S,5R)-2-(hydroxymethyl)-6-(4-methylanilino)oxyoxane-3,4,5-triol.
| Compound Name | (3S,5R)-2-(hydroxymethyl)-6-(4-methylanilino)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 143888765 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3S,5R)-2-(hydroxymethyl)-6-(4-methylanilino)oxyoxane-3,4,5-triol |
| SMILES | Cc1ccc(NOC2OC(CO)[C@@H](O)C(O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO6/c1-7-2-4-8(5-3-7)14-20-13-12(18)11(17)10(16)9(6-15)19-13/h2-5,9-18H,6H2,1H3/t9?,10-,11?,12-,13?/m1/s1 |
| InChIKey | MBESYRUACIKTID-BOHLEWGESA-N |
| XLogP | -0.86 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|