C20H30N3O4S+ — CID 143888780
CID 143888780 (PubChem CID 143888780) has the molecular formula C20H30N3O4S+ and a molecular weight of 408.54 g/mol.
| Compound Name | CID 143888780 |
|---|---|
| PubChem CID | 143888780 |
| Molecular Formula | C20H30N3O4S+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | — |
| SMILES | C[S+](=O)(O)c1ccc(OC2CN(C(=O)N3CCCN(C4CCC4)CC3)C2)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-28(25,26)19-8-6-17(7-9-19)27-18-14-23(15-18)20(24)22-11-3-10-21(12-13-22)16-4-2-5-16/h6-9,16,18H,2-5,10-15H2,1H3/p+1 |
| InChIKey | UINVIADTTJTUOL-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|