About ethane;5-methyl-1,3-oxazole-2-carboxamide
ethane;5-methyl-1,3-oxazole-2-carboxamide (PubChem CID 143888813) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is ethane;5-methyl-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | ethane;5-methyl-1,3-oxazole-2-carboxamide |
| PubChem CID | 143888813 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | ethane;5-methyl-1,3-oxazole-2-carboxamide |
| SMILES | CC.Cc1cnc(C(N)=O)o1 |
| InChI | InChI=1S/C5H6N2O2.C2H6/c1-3-2-7-5(9-3)4(6)8;1-2/h2H,1H3,(H2,6,8);1-2H3 |
| InChIKey | RCKDHPIWPCTRLR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methyl-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-1,3-oxazole-2-carboxamide?
The IUPAC name of ethane;5-methyl-1,3-oxazole-2-carboxamide (CID 143888813) is ethane;5-methyl-1,3-oxazole-2-carboxamide.
What is the SMILES notation for ethane;5-methyl-1,3-oxazole-2-carboxamide?
The canonical SMILES for ethane;5-methyl-1,3-oxazole-2-carboxamide is CC.Cc1cnc(C(N)=O)o1.
What is the InChIKey of ethane;5-methyl-1,3-oxazole-2-carboxamide?
The InChIKey is RCKDHPIWPCTRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.C2H6/c1-3-2-7-5(9-3)4(6)8;1-2/h2H,1H3,(H2,6,8);1-2H3.
What are the key properties of ethane;5-methyl-1,3-oxazole-2-carboxamide?
ethane;5-methyl-1,3-oxazole-2-carboxamide has a molecular weight of 156.18 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 143888813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).