About ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide
ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide (PubChem CID 143889078) has the molecular formula C12H18OS
and a molecular weight of 210.34 g/mol. Its IUPAC name is ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide.
Molecular Properties
| Compound Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide |
| PubChem CID | 143889078 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide |
| SMILES | CC.CC1CCS(=O)c2ccccc21 |
| InChI | InChI=1S/C10H12OS.C2H6/c1-8-6-7-12(11)10-5-3-2-4-9(8)10;1-2/h2-5,8H,6-7H2,1H3;1-2H3 |
| InChIKey | ZUALDKVQJYPDIM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide?
The IUPAC name of ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide (CID 143889078) is ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide.
What is the SMILES notation for ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide?
The canonical SMILES for ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide is CC.CC1CCS(=O)c2ccccc21.
What is the InChIKey of ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide?
The InChIKey is ZUALDKVQJYPDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS.C2H6/c1-8-6-7-12(11)10-5-3-2-4-9(8)10;1-2/h2-5,8H,6-7H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide?
ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide has a molecular weight of 210.34 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3,4-dihydro-2H-thiochromene 1-oxide is sourced from PubChem (CID 143889078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).