C24H30FN5S — CID 143889106
8-[(3-ethyl-2H-indazol-5-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decane (PubChem CID 143889106) has the molecular formula C24H30FN5S and a molecular weight of 439.60 g/mol. Its IUPAC name is 8-[(3-ethyl-2H-indazol-5-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decane.
| Compound Name | 8-[(3-ethyl-2H-indazol-5-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decane |
|---|---|
| PubChem CID | 143889106 |
| Molecular Formula | C24H30FN5S |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 8-[(3-ethyl-2H-indazol-5-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decane |
| SMILES | CCc1[nH]nc2ccc(CN3CCC4(CC3C)CN(C)SN4c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C24H30FN5S/c1-4-22-21-12-18(8-9-23(21)27-26-22)15-29-11-10-24(14-17(29)2)16-28(3)31-30(24)20-7-5-6-19(25)13-20/h5-9,12-13,17H,4,10-11,14-16H2,1-3H3,(H,26,27) |
| InChIKey | ZZPWFGVMDVNZBQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|