C25H36F2O3 — CID 143889555
5-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]-2-(4-pentylphenyl)oxane (PubChem CID 143889555) has the molecular formula C25H36F2O3 and a molecular weight of 422.56 g/mol. Its IUPAC name is 5-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]-2-(4-pentylphenyl)oxane.
| Compound Name | 5-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]-2-(4-pentylphenyl)oxane |
|---|---|
| PubChem CID | 143889555 |
| Molecular Formula | C25H36F2O3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 5-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]-2-(4-pentylphenyl)oxane |
| SMILES | CCCCCc1ccc(C2CCC(CO/C(CC)=C(F)/C(F)=C(\C)OC)CO2)cc1 |
| InChI | InChI=1S/C25H36F2O3/c1-5-7-8-9-19-10-13-21(14-11-19)23-15-12-20(17-30-23)16-29-22(6-2)25(27)24(26)18(3)28-4/h10-11,13-14,20,23H,5-9,12,15-17H2,1-4H3/b24-18-,25-22- |
| InChIKey | BRCWHZXSLHDNCC-IBNMDBNTSA-N |
| XLogP | 7.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|