C26H44F2O3 — CID 143889572
2-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-5-ethyloxane;propane (PubChem CID 143889572) has the molecular formula C26H44F2O3 and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-5-ethyloxane;propane.
| Compound Name | 2-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-5-ethyloxane;propane |
|---|---|
| PubChem CID | 143889572 |
| Molecular Formula | C26H44F2O3 |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 2-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-5-ethyloxane;propane |
| SMILES | CCC.CCC(=C(F)\C(F)=C(/C)OC)/C(C)=C/C=C(\CC)COC1CCC(CC)CO1 |
| InChI | InChI=1S/C23H36F2O3.C3H8/c1-7-18(14-27-21-13-12-19(8-2)15-28-21)11-10-16(4)20(9-3)23(25)22(24)17(5)26-6;1-3-2/h10-11,19,21H,7-9,12-15H2,1-6H3;3H2,1-2H3/b16-10+,18-11+,22-17-,23-20-; |
| InChIKey | NUBDFUCQOFYMQA-KNMPKLHWSA-N |
| XLogP | 8.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|