About 7-methyl-4,5-dihydro-1,3-benzodioxole
7-methyl-4,5-dihydro-1,3-benzodioxole (PubChem CID 143890601) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 7-methyl-4,5-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 7-methyl-4,5-dihydro-1,3-benzodioxole |
| PubChem CID | 143890601 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 7-methyl-4,5-dihydro-1,3-benzodioxole |
| SMILES | CC1=CCCC2=C1OCO2 |
| InChI | InChI=1S/C8H10O2/c1-6-3-2-4-7-8(6)10-5-9-7/h3H,2,4-5H2,1H3 |
| InChIKey | YCCZMRHXOZXLFU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-4,5-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4,5-dihydro-1,3-benzodioxole?
The IUPAC name of 7-methyl-4,5-dihydro-1,3-benzodioxole (CID 143890601) is 7-methyl-4,5-dihydro-1,3-benzodioxole.
What is the SMILES notation for 7-methyl-4,5-dihydro-1,3-benzodioxole?
The canonical SMILES for 7-methyl-4,5-dihydro-1,3-benzodioxole is CC1=CCCC2=C1OCO2.
What is the InChIKey of 7-methyl-4,5-dihydro-1,3-benzodioxole?
The InChIKey is YCCZMRHXOZXLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-6-3-2-4-7-8(6)10-5-9-7/h3H,2,4-5H2,1H3.
What are the key properties of 7-methyl-4,5-dihydro-1,3-benzodioxole?
7-methyl-4,5-dihydro-1,3-benzodioxole has a molecular weight of 138.17 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4,5-dihydro-1,3-benzodioxole is sourced from PubChem (CID 143890601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).