C20H22F3N3O4 — CID 143890808
fluoro (6S)-12-cyclopropyl-18-fluoro-15-oxo-8-oxa-2,12-diazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,13,16-tetraene-14-carboxylate;N-fluoromethanamine (PubChem CID 143890808) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is fluoro (6S)-12-cyclopropyl-18-fluoro-15-oxo-8-oxa-2,12-diazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,13,16-tetraene-14-carboxylate;N-fluoromethanamine.
| Compound Name | fluoro (6S)-12-cyclopropyl-18-fluoro-15-oxo-8-oxa-2,12-diazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,13,16-tetraene-14-carboxylate;N-fluoromethanamine |
|---|---|
| PubChem CID | 143890808 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | fluoro (6S)-12-cyclopropyl-18-fluoro-15-oxo-8-oxa-2,12-diazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,13,16-tetraene-14-carboxylate;N-fluoromethanamine |
| SMILES | CNF.O=C(OF)c1cn(C2CC2)c2c3c(c(F)cc2c1=O)N1CCC[C@H]1COC3 |
| InChI | InChI=1S/C19H18F2N2O4.CH4FN/c20-15-6-12-16(14-9-26-8-11-2-1-5-22(11)17(14)15)23(10-3-4-10)7-13(18(12)24)19(25)27-21;1-3-2/h6-7,10-11H,1-5,8-9H2;3H,1H3/t11-;/m0./s1 |
| InChIKey | DFRIEDGINKTQCR-MERQFXBCSA-N |
| XLogP | 3.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|