About ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one
ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one (PubChem CID 143892364) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one |
| PubChem CID | 143892364 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one |
| SMILES | C=Cc1[nH]c(=O)oc1C(=C)C.CC.CC |
| InChI | InChI=1S/C8H9NO2.2C2H6/c1-4-6-7(5(2)3)11-8(10)9-6;2*1-2/h4H,1-2H2,3H3,(H,9,10);2*1-2H3 |
| InChIKey | DWUDROFSXZFHOX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one?
The IUPAC name of ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one (CID 143892364) is ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one.
What is the SMILES notation for ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one?
The canonical SMILES for ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one is C=Cc1[nH]c(=O)oc1C(=C)C.CC.CC.
What is the InChIKey of ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one?
The InChIKey is DWUDROFSXZFHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.2C2H6/c1-4-6-7(5(2)3)11-8(10)9-6;2*1-2/h4H,1-2H2,3H3,(H,9,10);2*1-2H3.
What are the key properties of ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one?
ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one has a molecular weight of 211.30 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenyl-5-prop-1-en-2-yl-3H-1,3-oxazol-2-one is sourced from PubChem (CID 143892364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).