C20H21FN2OS — CID 143892518
S-methyl N-[(4S)-4-(3-fluorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate (PubChem CID 143892518) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is S-methyl N-[(4S)-4-(3-fluorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate.
| Compound Name | S-methyl N-[(4S)-4-(3-fluorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
|---|---|
| PubChem CID | 143892518 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | S-methyl N-[(4S)-4-(3-fluorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
| SMILES | CSC(=O)Nc1cc2c3c(c1)[C@H](c1cccc(F)c1)CCN3CCC2 |
| InChI | InChI=1S/C20H21FN2OS/c1-25-20(24)22-16-11-14-5-3-8-23-9-7-17(18(12-16)19(14)23)13-4-2-6-15(21)10-13/h2,4,6,10-12,17H,3,5,7-9H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | BYMYOFXXLKZKQB-KRWDZBQOSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|