C30H34F2N2OS — CID 143892539
fluorobenzene;S-propyl N-[4-(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate (PubChem CID 143892539) has the molecular formula C30H34F2N2OS and a molecular weight of 508.68 g/mol. Its IUPAC name is fluorobenzene;S-propyl N-[4-(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate.
| Compound Name | fluorobenzene;S-propyl N-[4-(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
|---|---|
| PubChem CID | 143892539 |
| Molecular Formula | C30H34F2N2OS |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | fluorobenzene;S-propyl N-[4-(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
| SMILES | CCCSC(=O)Nc1cc2c3c(c1)C(C)(c1ccc(F)cc1)CCN3CCC2C.Fc1ccccc1 |
| InChI | InChI=1S/C24H29FN2OS.C6H5F/c1-4-13-29-23(28)26-19-14-20-16(2)9-11-27-12-10-24(3,21(15-19)22(20)27)17-5-7-18(25)8-6-17;7-6-4-2-1-3-5-6/h5-8,14-16H,4,9-13H2,1-3H3,(H,26,28);1-5H |
| InChIKey | LXCUEBONXNNIEA-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|