C20H21ClN2O2 — CID 143892553
methyl N-[4-(4-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate (PubChem CID 143892553) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is methyl N-[4-(4-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate.
| Compound Name | methyl N-[4-(4-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
|---|---|
| PubChem CID | 143892553 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl N-[4-(4-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
| SMILES | COC(=O)Nc1cc2c3c(c1)C(c1ccc(Cl)cc1)CCN3CCC2 |
| InChI | InChI=1S/C20H21ClN2O2/c1-25-20(24)22-16-11-14-3-2-9-23-10-8-17(18(12-16)19(14)23)13-4-6-15(21)7-5-13/h4-7,11-12,17H,2-3,8-10H2,1H3,(H,22,24) |
| InChIKey | HVGSTGBTDSHSRF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|