C28H31Cl2N9O2 — CID 143892833
ethyl 2-[4-[5-[2-[(5-cyano-1,2-dihydropyridin-2-yl)amino]ethylamino]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]piperidin-1-yl]acetate (PubChem CID 143892833) has the molecular formula C28H31Cl2N9O2 and a molecular weight of 596.52 g/mol. Its IUPAC name is ethyl 2-[4-[5-[2-[(5-cyano-1,2-dihydropyridin-2-yl)amino]ethylamino]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[5-[2-[(5-cyano-1,2-dihydropyridin-2-yl)amino]ethylamino]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 143892833 |
| Molecular Formula | C28H31Cl2N9O2 |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | ethyl 2-[4-[5-[2-[(5-cyano-1,2-dihydropyridin-2-yl)amino]ethylamino]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(c2nc3cc(-c4ccc(Cl)cc4Cl)nc(NCCNC4C=CC(C#N)=CN4)n3n2)CC1 |
| InChI | InChI=1S/C28H31Cl2N9O2/c1-2-41-26(40)17-38-11-7-19(8-12-38)27-36-25-14-23(21-5-4-20(29)13-22(21)30)35-28(39(25)37-27)33-10-9-32-24-6-3-18(15-31)16-34-24/h3-6,13-14,16,19,24,32,34H,2,7-12,17H2,1H3,(H,33,35) |
| InChIKey | CABRNRQKMVNHJK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|