C10H12N4O — CID 143893473
12,12-dimethyl-1,4,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-11-one (PubChem CID 143893473) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 12,12-dimethyl-1,4,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-11-one.
| Compound Name | 12,12-dimethyl-1,4,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-11-one |
|---|---|
| PubChem CID | 143893473 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 12,12-dimethyl-1,4,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8-trien-11-one |
| SMILES | CC1(C)C(=O)NC2=Nc3cc[nH]c3CN21 |
| InChI | InChI=1S/C10H12N4O/c1-10(2)8(15)13-9-12-6-3-4-11-7(6)5-14(9)10/h3-4,11H,5H2,1-2H3,(H,12,13,15) |
| InChIKey | KZWVCOLPDBVHTJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |