C30H32F3N3O3 — CID 143893711
N-[(4-methylcyclohexyl)methyl]-1-(quinolin-6-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide;methyl formate (PubChem CID 143893711) has the molecular formula C30H32F3N3O3 and a molecular weight of 539.60 g/mol. Its IUPAC name is N-[(4-methylcyclohexyl)methyl]-1-(quinolin-6-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide;methyl formate.
| Compound Name | N-[(4-methylcyclohexyl)methyl]-1-(quinolin-6-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide;methyl formate |
|---|---|
| PubChem CID | 143893711 |
| Molecular Formula | C30H32F3N3O3 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[(4-methylcyclohexyl)methyl]-1-(quinolin-6-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide;methyl formate |
| SMILES | CC1CCC(CNC(=O)c2cc(C(F)(F)F)cc3ccn(Cc4ccc5ncccc5c4)c23)CC1.COC=O |
| InChI | InChI=1S/C28H28F3N3O.C2H4O2/c1-18-4-6-19(7-5-18)16-33-27(35)24-15-23(28(29,30)31)14-22-10-12-34(26(22)24)17-20-8-9-25-21(13-20)3-2-11-32-25;1-4-2-3/h2-3,8-15,18-19H,4-7,16-17H2,1H3,(H,33,35);2H,1H3 |
| InChIKey | YCMLTBSYFGZRFN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|