C17H29N — CID 143893789
N-but-1-en-2-yl-3-(3-methyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)butan-1-amine (PubChem CID 143893789) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N-but-1-en-2-yl-3-(3-methyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)butan-1-amine.
| Compound Name | N-but-1-en-2-yl-3-(3-methyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 143893789 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-but-1-en-2-yl-3-(3-methyl-1,2,3,3a,6,6a-hexahydropentalen-1-yl)butan-1-amine |
| SMILES | C=C(CC)NCCC(C)C1CC(C)C2C=CCC21 |
| InChI | InChI=1S/C17H29N/c1-5-14(4)18-10-9-12(2)17-11-13(3)15-7-6-8-16(15)17/h6-7,12-13,15-18H,4-5,8-11H2,1-3H3 |
| InChIKey | AALCKEWUJALTDM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|