C17H24O5S — CID 143893799
(2R)-2-[4-[cyclopropyl(dihydroxy)-λ4-sulfanyl]phenyl]-3-(oxan-4-yl)propanoic acid (PubChem CID 143893799) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is (2R)-2-[4-[cyclopropyl(dihydroxy)-λ4-sulfanyl]phenyl]-3-(oxan-4-yl)propanoic acid.
| Compound Name | (2R)-2-[4-[cyclopropyl(dihydroxy)-λ4-sulfanyl]phenyl]-3-(oxan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 143893799 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2R)-2-[4-[cyclopropyl(dihydroxy)-λ4-sulfanyl]phenyl]-3-(oxan-4-yl)propanoic acid |
| SMILES | O=C(O)[C@H](CC1CCOCC1)c1ccc(S(O)(O)C2CC2)cc1 |
| InChI | InChI=1S/C17H24O5S/c18-17(19)16(11-12-7-9-22-10-8-12)13-1-3-14(4-2-13)23(20,21)15-5-6-15/h1-4,12,15-16,20-21H,5-11H2,(H,18,19)/t16-/m1/s1 |
| InChIKey | QHLKXBOQWSHWCX-MRXNPFEDSA-N |
| XLogP | 3.94 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |