C17H20N2O5S — CID 143893976
2-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]sulfinyl-(2-oxoethyl)amino]-N-hydroxyacetamide (PubChem CID 143893976) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]sulfinyl-(2-oxoethyl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]sulfinyl-(2-oxoethyl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 143893976 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]sulfinyl-(2-oxoethyl)amino]-N-hydroxyacetamide |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(S(=O)N(CC=O)CC(=O)NO)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-3-5-6-14(4-2)24-15-7-9-16(10-8-15)25(23)19(11-12-20)13-17(21)18-22/h3-10,12,22H,2,11,13H2,1H3,(H,18,21)/b5-3-,14-6+ |
| InChIKey | YUHKYOPZFVRIBV-RGWZVXDZSA-N |
| XLogP | 1.74 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|