About 1-methylnaphthalene-2-sulfonic acid;2-methylpropane
1-methylnaphthalene-2-sulfonic acid;2-methylpropane (PubChem CID 143894377) has the molecular formula C15H20O3S
and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-methylnaphthalene-2-sulfonic acid;2-methylpropane.
Molecular Properties
| Compound Name | 1-methylnaphthalene-2-sulfonic acid;2-methylpropane |
| PubChem CID | 143894377 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-methylnaphthalene-2-sulfonic acid;2-methylpropane |
| SMILES | CC(C)C.Cc1c(S(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C11H10O3S.C4H10/c1-8-10-5-3-2-4-9(10)6-7-11(8)15(12,13)14;1-4(2)3/h2-7H,1H3,(H,12,13,14);4H,1-3H3 |
| InChIKey | SCJPESVIVHBJDN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylnaphthalene-2-sulfonic acid;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylnaphthalene-2-sulfonic acid;2-methylpropane?
The IUPAC name of 1-methylnaphthalene-2-sulfonic acid;2-methylpropane (CID 143894377) is 1-methylnaphthalene-2-sulfonic acid;2-methylpropane.
What is the SMILES notation for 1-methylnaphthalene-2-sulfonic acid;2-methylpropane?
The canonical SMILES for 1-methylnaphthalene-2-sulfonic acid;2-methylpropane is CC(C)C.Cc1c(S(=O)(=O)O)ccc2ccccc12.
What is the InChIKey of 1-methylnaphthalene-2-sulfonic acid;2-methylpropane?
The InChIKey is SCJPESVIVHBJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3S.C4H10/c1-8-10-5-3-2-4-9(10)6-7-11(8)15(12,13)14;1-4(2)3/h2-7H,1H3,(H,12,13,14);4H,1-3H3.
What are the key properties of 1-methylnaphthalene-2-sulfonic acid;2-methylpropane?
1-methylnaphthalene-2-sulfonic acid;2-methylpropane has a molecular weight of 280.39 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylnaphthalene-2-sulfonic acid;2-methylpropane is sourced from PubChem (CID 143894377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).