C24H28FN7S — CID 143894715
(Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-[2-(piperazin-1-ylmethyl)-1,3-thiazol-4-yl]-1H-imidazol-2-yl]prop-2-en-1-imine (PubChem CID 143894715) has the molecular formula C24H28FN7S and a molecular weight of 465.60 g/mol. Its IUPAC name is (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-[2-(piperazin-1-ylmethyl)-1,3-thiazol-4-yl]-1H-imidazol-2-yl]prop-2-en-1-imine.
| Compound Name | (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-[2-(piperazin-1-ylmethyl)-1,3-thiazol-4-yl]-1H-imidazol-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 143894715 |
| Molecular Formula | C24H28FN7S |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-[2-(piperazin-1-ylmethyl)-1,3-thiazol-4-yl]-1H-imidazol-2-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2csc(CN3CCNCC3)n2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C24H28FN7S/c25-18-4-1-3-17(13-18)21-5-2-10-32(21)22(26)6-7-23-28-14-19(29-23)20-16-33-24(30-20)15-31-11-8-27-9-12-31/h1,3-4,6-7,13-14,16,21,26-27H,2,5,8-12,15H2,(H,28,29)/b7-6-,26-22- |
| InChIKey | QXNRUZVTKCTGBW-IVKISMCHSA-N |
| XLogP | 3.91 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|