About 5-methyl-2-propoxy-1,3-thiazole
5-methyl-2-propoxy-1,3-thiazole (PubChem CID 143895190) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is 5-methyl-2-propoxy-1,3-thiazole.
Molecular Properties
| Compound Name | 5-methyl-2-propoxy-1,3-thiazole |
| PubChem CID | 143895190 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 5-methyl-2-propoxy-1,3-thiazole |
| SMILES | CCCOc1ncc(C)s1 |
| InChI | InChI=1S/C7H11NOS/c1-3-4-9-7-8-5-6(2)10-7/h5H,3-4H2,1-2H3 |
| InChIKey | PFVUGHSVVKWCDJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-propoxy-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propoxy-1,3-thiazole?
The IUPAC name of 5-methyl-2-propoxy-1,3-thiazole (CID 143895190) is 5-methyl-2-propoxy-1,3-thiazole.
What is the SMILES notation for 5-methyl-2-propoxy-1,3-thiazole?
The canonical SMILES for 5-methyl-2-propoxy-1,3-thiazole is CCCOc1ncc(C)s1.
What is the InChIKey of 5-methyl-2-propoxy-1,3-thiazole?
The InChIKey is PFVUGHSVVKWCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c1-3-4-9-7-8-5-6(2)10-7/h5H,3-4H2,1-2H3.
What are the key properties of 5-methyl-2-propoxy-1,3-thiazole?
5-methyl-2-propoxy-1,3-thiazole has a molecular weight of 157.24 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propoxy-1,3-thiazole is sourced from PubChem (CID 143895190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).