C29H38ClF3O5 — CID 143895199
prop-2-enyl (Z)-7-[(1R,3R,5R)-5-chloro-3-(oxan-2-yloxy)-2-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclopentyl]hept-5-enoate (PubChem CID 143895199) has the molecular formula C29H38ClF3O5 and a molecular weight of 559.07 g/mol. Its IUPAC name is prop-2-enyl (Z)-7-[(1R,3R,5R)-5-chloro-3-(oxan-2-yloxy)-2-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl (Z)-7-[(1R,3R,5R)-5-chloro-3-(oxan-2-yloxy)-2-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 143895199 |
| Molecular Formula | C29H38ClF3O5 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | prop-2-enyl (Z)-7-[(1R,3R,5R)-5-chloro-3-(oxan-2-yloxy)-2-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCC/C=C\C[C@@H]1C(COCc2cccc(C(F)(F)F)c2)[C@H](OC2CCCCO2)C[C@H]1Cl |
| InChI | InChI=1S/C29H38ClF3O5/c1-2-15-36-27(34)13-6-4-3-5-12-23-24(26(18-25(23)30)38-28-14-7-8-16-37-28)20-35-19-21-10-9-11-22(17-21)29(31,32)33/h2-3,5,9-11,17,23-26,28H,1,4,6-8,12-16,18-20H2/b5-3-/t23-,24?,25-,26-,28?/m1/s1 |
| InChIKey | BJDNTJQYDUBSBA-HDMWZNBHSA-N |
| XLogP | 7.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|