About 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile
4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile (PubChem CID 143895436) has the molecular formula C14H11BN2O2S
and a molecular weight of 282.13 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile |
| PubChem CID | 143895436 |
| Molecular Formula | C14H11BN2O2S |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(SNc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C14H11BN2O2S/c16-8-10-1-5-13(6-2-10)20-17-12-4-3-11-9-19-15(18)14(11)7-12/h1-7,17-18H,9H2 |
| InChIKey | NNIYRVKVCSZBPC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile?
The IUPAC name of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile (CID 143895436) is 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile.
What is the SMILES notation for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile?
The canonical SMILES for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile is N#Cc1ccc(SNc2ccc3c(c2)B(O)OC3)cc1.
What is the InChIKey of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile?
The InChIKey is NNIYRVKVCSZBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BN2O2S/c16-8-10-1-5-13(6-2-10)20-17-12-4-3-11-9-19-15(18)14(11)7-12/h1-7,17-18H,9H2.
What are the key properties of 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile?
4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile has a molecular weight of 282.13 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]sulfanylbenzonitrile is sourced from PubChem (CID 143895436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).