About cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen
cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen (PubChem CID 143895446) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen |
| PubChem CID | 143895446 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen |
| SMILES | C[C@H]1CCNCC1NC(=O)OCC1=CCCC=C1.[H][H].[H][H] |
| InChI | InChI=1S/C14H22N2O2.2H2/c1-11-7-8-15-9-13(11)16-14(17)18-10-12-5-3-2-4-6-12;;/h3,5-6,11,13,15H,2,4,7-10H2,1H3,(H,16,17);2*1H/t11-,13?;;/m0../s1 |
| InChIKey | GCLWOHIWUWXSOU-VDWHCVNUSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen (CID 143895446) is cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen is C[C@H]1CCNCC1NC(=O)OCC1=CCCC=C1.[H][H].[H][H].
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen?
The InChIKey is GCLWOHIWUWXSOU-VDWHCVNUSA-N. The full InChI is InChI=1S/C14H22N2O2.2H2/c1-11-7-8-15-9-13(11)16-14(17)18-10-12-5-3-2-4-6-12;;/h3,5-6,11,13,15H,2,4,7-10H2,1H3,(H,16,17);2*1H/t11-,13?;;/m0../s1.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen?
cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen has a molecular weight of 254.37 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl N-[(4S)-4-methylpiperidin-3-yl]carbamate;molecular hydrogen is sourced from PubChem (CID 143895446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).