C23H30N6O3S — CID 143896289
tert-butyl 4-[4-[4-(dimethylaminosulfanyl)phenoxy]pyrazolo[5,4-d]pyrimidin-1-yl]piperidine-1-carboxylate (PubChem CID 143896289) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(dimethylaminosulfanyl)phenoxy]pyrazolo[5,4-d]pyrimidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(dimethylaminosulfanyl)phenoxy]pyrazolo[5,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143896289 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | tert-butyl 4-[4-[4-(dimethylaminosulfanyl)phenoxy]pyrazolo[5,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
| SMILES | CN(C)Sc1ccc(Oc2ncnc3c2cnn3C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H30N6O3S/c1-23(2,3)32-22(30)28-12-10-16(11-13-28)29-20-19(14-26-29)21(25-15-24-20)31-17-6-8-18(9-7-17)33-27(4)5/h6-9,14-16H,10-13H2,1-5H3 |
| InChIKey | SVTHVSBVKKQZKS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|